C13H19FNO4P — CID 169218939
propyl 2-[[1-fluoroethyl(phenoxy)phosphoryl]amino]acetate (PubChem CID 169218939) has the molecular formula C13H19FNO4P and a molecular weight of 303.27 g/mol. Its IUPAC name is propyl 2-[[1-fluoroethyl(phenoxy)phosphoryl]amino]acetate.
| Compound Name | propyl 2-[[1-fluoroethyl(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 169218939 |
| Molecular Formula | C13H19FNO4P |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | propyl 2-[[1-fluoroethyl(phenoxy)phosphoryl]amino]acetate |
| SMILES | CCCOC(=O)CNP(=O)(Oc1ccccc1)C(C)F |
| InChI | InChI=1S/C13H19FNO4P/c1-3-9-18-13(16)10-15-20(17,11(2)14)19-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3,(H,15,17) |
| InChIKey | AGAXJYMOYGZIQN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|