C10H15N2O4P — CID 156841904
ethyl 2-[[amino(phenoxy)phosphoryl]amino]acetate (PubChem CID 156841904) has the molecular formula C10H15N2O4P and a molecular weight of 258.21 g/mol. Its IUPAC name is ethyl 2-[[amino(phenoxy)phosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[amino(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 156841904 |
| Molecular Formula | C10H15N2O4P |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | ethyl 2-[[amino(phenoxy)phosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(N)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C10H15N2O4P/c1-2-15-10(13)8-12-17(11,14)16-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H3,11,12,14) |
| InChIKey | DLEFHYDQWPGGMH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|