C14H23N2O4P — CID 71216005
ethyl 2-[[3-(methylamino)propyl-phenoxyphosphoryl]amino]acetate (PubChem CID 71216005) has the molecular formula C14H23N2O4P and a molecular weight of 314.32 g/mol. Its IUPAC name is ethyl 2-[[3-(methylamino)propyl-phenoxyphosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[3-(methylamino)propyl-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 71216005 |
| Molecular Formula | C14H23N2O4P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | ethyl 2-[[3-(methylamino)propyl-phenoxyphosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(CCCNC)Oc1ccccc1 |
| InChI | InChI=1S/C14H23N2O4P/c1-3-19-14(17)12-16-21(18,11-7-10-15-2)20-13-8-5-4-6-9-13/h4-6,8-9,15H,3,7,10-12H2,1-2H3,(H,16,18) |
| InChIKey | RTMQEVRJTBJUAU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|