C20H24NO5P — CID 139528389
ethyl 2-[[[(E)-4-methyl-5-oxopent-3-enyl]-naphthalen-2-yloxyphosphoryl]amino]acetate (PubChem CID 139528389) has the molecular formula C20H24NO5P and a molecular weight of 389.39 g/mol. Its IUPAC name is ethyl 2-[[[(E)-4-methyl-5-oxopent-3-enyl]-naphthalen-2-yloxyphosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[[(E)-4-methyl-5-oxopent-3-enyl]-naphthalen-2-yloxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 139528389 |
| Molecular Formula | C20H24NO5P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 2-[[[(E)-4-methyl-5-oxopent-3-enyl]-naphthalen-2-yloxyphosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(CC/C=C(\C)C=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H24NO5P/c1-3-25-20(23)14-21-27(24,12-6-7-16(2)15-22)26-19-11-10-17-8-4-5-9-18(17)13-19/h4-5,7-11,13,15H,3,6,12,14H2,1-2H3,(H,21,24)/b16-7+ |
| InChIKey | WTNRGXSMQAMEDL-FRKPEAEDSA-N |
| XLogP | 4.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|