C14H22NO4PS — CID 123690303
propan-2-yl 2-[[2-methylsulfanylethyl(phenoxy)phosphoryl]amino]acetate (PubChem CID 123690303) has the molecular formula C14H22NO4PS and a molecular weight of 331.37 g/mol. Its IUPAC name is propan-2-yl 2-[[2-methylsulfanylethyl(phenoxy)phosphoryl]amino]acetate.
| Compound Name | propan-2-yl 2-[[2-methylsulfanylethyl(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 123690303 |
| Molecular Formula | C14H22NO4PS |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | propan-2-yl 2-[[2-methylsulfanylethyl(phenoxy)phosphoryl]amino]acetate |
| SMILES | CSCCP(=O)(NCC(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C14H22NO4PS/c1-12(2)18-14(16)11-15-20(17,9-10-21-3)19-13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3,(H,15,17) |
| InChIKey | LLEBRJHBUWJXCK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|