C12H17ClNO4P — CID 145372538
propan-2-yl 2-[[chloro(phenylmethoxy)phosphoryl]amino]acetate (PubChem CID 145372538) has the molecular formula C12H17ClNO4P and a molecular weight of 305.70 g/mol. Its IUPAC name is propan-2-yl 2-[[chloro(phenylmethoxy)phosphoryl]amino]acetate.
| Compound Name | propan-2-yl 2-[[chloro(phenylmethoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 145372538 |
| Molecular Formula | C12H17ClNO4P |
| Molecular Weight | 305.70 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | propan-2-yl 2-[[chloro(phenylmethoxy)phosphoryl]amino]acetate |
| SMILES | CC(C)OC(=O)CNP(=O)(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C12H17ClNO4P/c1-10(2)18-12(15)8-14-19(13,16)17-9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,14,16) |
| InChIKey | NNCNUALCYFOQQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|