About ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate
ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate (PubChem CID 145444503) has the molecular formula C14H26NO3P
and a molecular weight of 287.34 g/mol. Its IUPAC name is ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate.
Molecular Properties
| Compound Name | ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate |
| PubChem CID | 145444503 |
| Molecular Formula | C14H26NO3P |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate |
| SMILES | CC.CPNCC(=O)OC(C)C.Oc1ccccc1 |
| InChI | InChI=1S/C6H14NO2P.C6H6O.C2H6/c1-5(2)9-6(8)4-7-10-3;7-6-4-2-1-3-5-6;1-2/h5,7,10H,4H2,1-3H3;1-5,7H;1-2H3 |
| InChIKey | HJUNOQJAYXERND-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate?
The IUPAC name of ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate (CID 145444503) is ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate.
What is the SMILES notation for ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate?
The canonical SMILES for ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate is CC.CPNCC(=O)OC(C)C.Oc1ccccc1.
What is the InChIKey of ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate?
The InChIKey is HJUNOQJAYXERND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NO2P.C6H6O.C2H6/c1-5(2)9-6(8)4-7-10-3;7-6-4-2-1-3-5-6;1-2/h5,7,10H,4H2,1-3H3;1-5,7H;1-2H3.
What are the key properties of ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate?
ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate has a molecular weight of 287.34 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;phenol;propan-2-yl 2-(methylphosphanylamino)acetate is sourced from PubChem (CID 145444503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).