C15H28NO5P — CID 162736895
ethane;N-(2-oxo-2-propan-2-yloxyethyl)-phenoxyphosphonamidic acid (PubChem CID 162736895) has the molecular formula C15H28NO5P and a molecular weight of 333.37 g/mol. Its IUPAC name is ethane;N-(2-oxo-2-propan-2-yloxyethyl)-phenoxyphosphonamidic acid.
| Compound Name | ethane;N-(2-oxo-2-propan-2-yloxyethyl)-phenoxyphosphonamidic acid |
|---|---|
| PubChem CID | 162736895 |
| Molecular Formula | C15H28NO5P |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethane;N-(2-oxo-2-propan-2-yloxyethyl)-phenoxyphosphonamidic acid |
| SMILES | CC.CC.CC(C)OC(=O)CNP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C11H16NO5P.2C2H6/c1-9(2)16-11(13)8-12-18(14,15)17-10-6-4-3-5-7-10;2*1-2/h3-7,9H,8H2,1-2H3,(H2,12,14,15);2*1-2H3 |
| InChIKey | XSCGUKBPLZFXSY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|