C12H16NO6P — CID 122698874
N-(5-methoxy-2,5-dioxopentyl)-phenoxyphosphonamidic acid (PubChem CID 122698874) has the molecular formula C12H16NO6P and a molecular weight of 301.23 g/mol. Its IUPAC name is N-(5-methoxy-2,5-dioxopentyl)-phenoxyphosphonamidic acid.
| Compound Name | N-(5-methoxy-2,5-dioxopentyl)-phenoxyphosphonamidic acid |
|---|---|
| PubChem CID | 122698874 |
| Molecular Formula | C12H16NO6P |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(5-methoxy-2,5-dioxopentyl)-phenoxyphosphonamidic acid |
| SMILES | COC(=O)CCC(=O)CNP(=O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C12H16NO6P/c1-18-12(15)8-7-10(14)9-13-20(16,17)19-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H2,13,16,17) |
| InChIKey | VDDSPUGLSLKXIN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|