C29H46NO8P — CID 162095205
hexyl 6-[[(5-hexoxy-2,5-dioxopentyl)amino]-phenoxyphosphoryl]-4-oxohexanoate (PubChem CID 162095205) has the molecular formula C29H46NO8P and a molecular weight of 567.66 g/mol. Its IUPAC name is hexyl 6-[[(5-hexoxy-2,5-dioxopentyl)amino]-phenoxyphosphoryl]-4-oxohexanoate.
| Compound Name | hexyl 6-[[(5-hexoxy-2,5-dioxopentyl)amino]-phenoxyphosphoryl]-4-oxohexanoate |
|---|---|
| PubChem CID | 162095205 |
| Molecular Formula | C29H46NO8P |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | hexyl 6-[[(5-hexoxy-2,5-dioxopentyl)amino]-phenoxyphosphoryl]-4-oxohexanoate |
| SMILES | CCCCCCOC(=O)CCC(=O)CCP(=O)(NCC(=O)CCC(=O)OCCCCCC)Oc1ccccc1 |
| InChI | InChI=1S/C29H46NO8P/c1-3-5-7-12-21-36-28(33)18-16-25(31)20-23-39(35,38-27-14-10-9-11-15-27)30-24-26(32)17-19-29(34)37-22-13-8-6-4-2/h9-11,14-15H,3-8,12-13,16-24H2,1-2H3,(H,30,35) |
| InChIKey | ZEDQABUEBPJNBD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|