C16H30NO5P — CID 162736864
ethane;propan-2-yl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate (PubChem CID 162736864) has the molecular formula C16H30NO5P and a molecular weight of 347.39 g/mol. Its IUPAC name is ethane;propan-2-yl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate.
| Compound Name | ethane;propan-2-yl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 162736864 |
| Molecular Formula | C16H30NO5P |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethane;propan-2-yl 2-[[methoxy(phenoxy)phosphoryl]amino]acetate |
| SMILES | CC.CC.COP(=O)(NCC(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C12H18NO5P.2C2H6/c1-10(2)17-12(14)9-13-19(15,16-3)18-11-7-5-4-6-8-11;2*1-2/h4-8,10H,9H2,1-3H3,(H,13,15);2*1-2H3 |
| InChIKey | ZXJLMTSDBMNMTE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|