C20H27N2O7P — CID 168931345
propan-2-yl 2-[[[(2Z,4E)-3-formyl-4-hydroxy-2-methyl-5-(methylideneamino)hexa-2,4-dienoxy]-phenoxyphosphoryl]amino]acetate (PubChem CID 168931345) has the molecular formula C20H27N2O7P and a molecular weight of 438.42 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2Z,4E)-3-formyl-4-hydroxy-2-methyl-5-(methylideneamino)hexa-2,4-dienoxy]-phenoxyphosphoryl]amino]acetate.
| Compound Name | propan-2-yl 2-[[[(2Z,4E)-3-formyl-4-hydroxy-2-methyl-5-(methylideneamino)hexa-2,4-dienoxy]-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 168931345 |
| Molecular Formula | C20H27N2O7P |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | propan-2-yl 2-[[[(2Z,4E)-3-formyl-4-hydroxy-2-methyl-5-(methylideneamino)hexa-2,4-dienoxy]-phenoxyphosphoryl]amino]acetate |
| SMILES | C=N/C(C)=C(O)\C(C=O)=C(/C)COP(=O)(NCC(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C20H27N2O7P/c1-14(2)28-19(24)11-22-30(26,29-17-9-7-6-8-10-17)27-13-15(3)18(12-23)20(25)16(4)21-5/h6-10,12,14,25H,5,11,13H2,1-4H3,(H,22,26)/b18-15+,20-16+ |
| InChIKey | CVOWLCXBFOKCNE-GRKJIKSTSA-N |
| XLogP | 3.74 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|