C15H21F2O5P — CID 169218831
propan-2-yl 2-[(1,1-difluoro-2-methylpropyl)-phenoxyphosphoryl]oxyacetate (PubChem CID 169218831) has the molecular formula C15H21F2O5P and a molecular weight of 350.30 g/mol. Its IUPAC name is propan-2-yl 2-[(1,1-difluoro-2-methylpropyl)-phenoxyphosphoryl]oxyacetate.
| Compound Name | propan-2-yl 2-[(1,1-difluoro-2-methylpropyl)-phenoxyphosphoryl]oxyacetate |
|---|---|
| PubChem CID | 169218831 |
| Molecular Formula | C15H21F2O5P |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | propan-2-yl 2-[(1,1-difluoro-2-methylpropyl)-phenoxyphosphoryl]oxyacetate |
| SMILES | CC(C)OC(=O)COP(=O)(Oc1ccccc1)C(F)(F)C(C)C |
| InChI | InChI=1S/C15H21F2O5P/c1-11(2)15(16,17)23(19,20-10-14(18)21-12(3)4)22-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | AVJWZJSFYOJNLB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|