C19H17F5NO5P — CID 129121078
propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]methylideneamino]propanoate (PubChem CID 129121078) has the molecular formula C19H17F5NO5P and a molecular weight of 465.31 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]methylideneamino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]methylideneamino]propanoate |
|---|---|
| PubChem CID | 129121078 |
| Molecular Formula | C19H17F5NO5P |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]methylideneamino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)/N=C/P(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H17F5NO5P/c1-10(2)28-19(26)11(3)25-9-31(27,29-12-7-5-4-6-8-12)30-18-16(23)14(21)13(20)15(22)17(18)24/h4-11H,1-3H3/b25-9+/t11-,31?/m0/s1 |
| InChIKey | QXLZZFGKALBZEF-HSLOOCGKSA-N |
| XLogP | 5.40 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|