C18H17F5NO5P — CID 122485284
methyl (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoate (PubChem CID 122485284) has the molecular formula C18H17F5NO5P and a molecular weight of 453.30 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 122485284 |
| Molecular Formula | C18H17F5NO5P |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C18H17F5NO5P/c1-9(2)16(18(25)27-3)24-30(26,28-10-7-5-4-6-8-10)29-17-14(22)12(20)11(19)13(21)15(17)23/h4-9,16H,1-3H3,(H,24,26)/t16-,30?/m0/s1 |
| InChIKey | HWBYMIZKWPDUSD-XSTXYMSBSA-N |
| XLogP | 4.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|