C19H18F5O4PW — CID 140741005
[[(2R)-2-methyl-3-oxo-3-propan-2-yloxypropyl]-(2,3,4,5,6-pentafluorophenoxy)-phenoxy-λ5-phosphanylidene]tungsten (PubChem CID 140741005) has the molecular formula C19H18F5O4PW and a molecular weight of 620.15 g/mol. Its IUPAC name is [[(2R)-2-methyl-3-oxo-3-propan-2-yloxypropyl]-(2,3,4,5,6-pentafluorophenoxy)-phenoxy-λ5-phosphanylidene]tungsten.
| Compound Name | [[(2R)-2-methyl-3-oxo-3-propan-2-yloxypropyl]-(2,3,4,5,6-pentafluorophenoxy)-phenoxy-λ5-phosphanylidene]tungsten |
|---|---|
| PubChem CID | 140741005 |
| Molecular Formula | C19H18F5O4PW |
| Molecular Weight | 620.15 g/mol |
| Exact Mass | 620.04 |
| IUPAC Name | [[(2R)-2-methyl-3-oxo-3-propan-2-yloxypropyl]-(2,3,4,5,6-pentafluorophenoxy)-phenoxy-λ5-phosphanylidene]tungsten |
| SMILES | CC(C)OC(=O)[C@@H](C)CP(=[W])(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H18F5O4P.W/c1-10(2)26-19(25)11(3)9-29(27-12-7-5-4-6-8-12)28-18-16(23)14(21)13(20)15(22)17(18)24;/h4-8,10-11H,9H2,1-3H3;/t11-,29?;/m0./s1 |
| InChIKey | BJHNZZQWZVHDNE-ZZKYIAMPSA-N |
| XLogP | 5.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|