C26H38N3O8P — CID 177364816
propane-2,2-diol;propan-2-yl 2-[[[2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)butoxy]-phenoxyphosphoryl]amino]acetate (PubChem CID 177364816) has the molecular formula C26H38N3O8P and a molecular weight of 551.58 g/mol. Its IUPAC name is propane-2,2-diol;propan-2-yl 2-[[[2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)butoxy]-phenoxyphosphoryl]amino]acetate.
| Compound Name | propane-2,2-diol;propan-2-yl 2-[[[2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)butoxy]-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 177364816 |
| Molecular Formula | C26H38N3O8P |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | propane-2,2-diol;propan-2-yl 2-[[[2-methoxy-4-(1H-pyrrolo[2,3-b]pyridin-4-yl)butoxy]-phenoxyphosphoryl]amino]acetate |
| SMILES | CC(C)(O)O.COC(CCc1ccnc2[nH]ccc12)CO[P@@](=O)(NCC(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C23H30N3O6P.C3H8O2/c1-17(2)31-22(27)15-26-33(28,32-19-7-5-4-6-8-19)30-16-20(29-3)10-9-18-11-13-24-23-21(18)12-14-25-23;1-3(2,4)5/h4-8,11-14,17,20H,9-10,15-16H2,1-3H3,(H,24,25)(H,26,28);4-5H,1-2H3/t20?,33-;/m0./s1 |
| InChIKey | IOIGMNCAUGLZHK-MCBLWXHZSA-N |
| XLogP | 3.96 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|