C19H27N4O8P — CID 135258835
methyl 2-[[[4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 135258835) has the molecular formula C19H27N4O8P and a molecular weight of 470.42 g/mol. Its IUPAC name is methyl 2-[[[4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135258835 |
| Molecular Formula | C19H27N4O8P |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | methyl 2-[[[4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCC(CCn1cnc(C(N)=O)c1O)OC)Oc1ccccc1 |
| InChI | InChI=1S/C19H27N4O8P/c1-13(19(26)29-3)22-32(27,31-14-7-5-4-6-8-14)30-11-15(28-2)9-10-23-12-21-16(17(20)24)18(23)25/h4-8,12-13,15,25H,9-11H2,1-3H3,(H2,20,24)(H,22,27) |
| InChIKey | ICMGMHONFPBAPS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|