C20H24N7O5P — CID 3002847
methyl 2-[[[(1R,2Z)-2-[(2,6-diaminopurin-9-yl)methylidene]cyclopropyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 3002847) has the molecular formula C20H24N7O5P and a molecular weight of 473.43 g/mol. Its IUPAC name is methyl 2-[[[(1R,2Z)-2-[(2,6-diaminopurin-9-yl)methylidene]cyclopropyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[(1R,2Z)-2-[(2,6-diaminopurin-9-yl)methylidene]cyclopropyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 3002847 |
| Molecular Formula | C20H24N7O5P |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | methyl 2-[[[(1R,2Z)-2-[(2,6-diaminopurin-9-yl)methylidene]cyclopropyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OC[C@@H]1C/C1=C/n1cnc2c(N)nc(N)nc21)Oc1ccccc1 |
| InChI | InChI=1S/C20H24N7O5P/c1-12(19(28)30-2)26-33(29,32-15-6-4-3-5-7-15)31-10-14-8-13(14)9-27-11-23-16-17(21)24-20(22)25-18(16)27/h3-7,9,11-12,14H,8,10H2,1-2H3,(H,26,29)(H4,21,22,24,25)/b13-9-/t12?,14-,33?/m0/s1 |
| InChIKey | XHUFBJWIETZGNX-PEXPTUSVSA-N |
| XLogP | 2.21 |
| TPSA | 169.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|