C24H33FN7O6P — CID 139294022
propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5R)-4-(2,6-diaminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 139294022) has the molecular formula C24H33FN7O6P and a molecular weight of 565.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5R)-4-(2,6-diaminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5R)-4-(2,6-diaminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139294022 |
| Molecular Formula | C24H33FN7O6P |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2R,3S,4R,5R)-4-(2,6-diaminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1[C@@H](C)[C@@H](n2cnc3c(N)nc(N)nc32)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H33FN7O6P/c1-12(2)37-23(34)14(4)31-39(35,38-15-8-6-5-7-9-15)36-10-16-13(3)19(17(25)20(16)33)32-11-28-18-21(26)29-24(27)30-22(18)32/h5-9,11-14,16-17,19-20,33H,10H2,1-4H3,(H,31,35)(H4,26,27,29,30)/t13-,14+,16+,17+,19-,20-,39+/m1/s1 |
| InChIKey | LEDLRGMLNIWEBA-SFRZDEDMSA-N |
| XLogP | 2.63 |
| TPSA | 189.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|