C21H27N6O7P — CID 134330262
2-[[[(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 134330262) has the molecular formula C21H27N6O7P and a molecular weight of 506.46 g/mol. Its IUPAC name is 2-[[[(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 134330262 |
| Molecular Formula | C21H27N6O7P |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2-[[[(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxy-5-methylcyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(N[P@](=O)(OC[C@H]1C(C)[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H27N6O7P/c1-11-14(8-33-35(32,26-12(2)21(30)31)34-13-6-4-3-5-7-13)17(28)18(29)16(11)27-10-25-15-19(22)23-9-24-20(15)27/h3-7,9-12,14,16-18,28-29H,8H2,1-2H3,(H,26,32)(H,30,31)(H2,22,23,24)/t11?,12?,14-,16+,17+,18-,35-/m0/s1 |
| InChIKey | NVOYOLQJZWBCGA-ZIBHSKSLSA-N |
| XLogP | 1.20 |
| TPSA | 194.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|