C24H30FN6O6P — CID 171837004
propan-2-yl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 171837004) has the molecular formula C24H30FN6O6P and a molecular weight of 548.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171837004 |
| Molecular Formula | C24H30FN6O6P |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,2R,3R,4R)-4-(6-aminopurin-9-yl)-3-fluoro-2-hydroxy-5-methylidenecyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1[C@@H](n2cnc3c(N)ncnc32)[C@@H](F)[C@H](O)[C@H]1COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C24H30FN6O6P/c1-13(2)36-24(33)15(4)30-38(34,37-16-8-6-5-7-9-16)35-10-17-14(3)20(18(25)21(17)32)31-12-29-19-22(26)27-11-28-23(19)31/h5-9,11-13,15,17-18,20-21,32H,3,10H2,1-2,4H3,(H,30,34)(H2,26,27,28)/t15-,17-,18+,20+,21+,38?/m0/s1 |
| InChIKey | KEEAEGCONKDYAO-NSAZHIHISA-N |
| XLogP | 2.97 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|