C23H30N9O7P — CID 90444951
propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90444951) has the molecular formula C23H30N9O7P and a molecular weight of 575.52 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90444951 |
| Molecular Formula | C23H30N9O7P |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@](C)(N=[N+]=[N-])[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H30N9O7P/c1-13(2)37-21(34)14(3)29-40(35,39-15-8-6-5-7-9-15)36-10-16-18(33)23(4,30-31-25)22(38-16)32-12-28-17-19(24)26-11-27-20(17)32/h5-9,11-14,16,18,22,33H,10H2,1-4H3,(H,29,35)(H2,24,26,27)/t14-,16-,18-,22-,23-,40?/m1/s1 |
| InChIKey | HHLJBOFKDWIPJK-UXMWETOESA-N |
| XLogP | 2.87 |
| TPSA | 221.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|