C19H28NO6P — CID 144582269
propan-2-yl (2S)-2-[[[(2S)-2-methoxyhex-4-ynoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144582269) has the molecular formula C19H28NO6P and a molecular weight of 397.41 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S)-2-methoxyhex-4-ynoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S)-2-methoxyhex-4-ynoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144582269 |
| Molecular Formula | C19H28NO6P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S)-2-methoxyhex-4-ynoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC#CC[C@@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)OC |
| InChI | InChI=1S/C19H28NO6P/c1-6-7-11-18(23-5)14-24-27(22,26-17-12-9-8-10-13-17)20-16(4)19(21)25-15(2)3/h8-10,12-13,15-16,18H,11,14H2,1-5H3,(H,20,22)/t16-,18-,27?/m0/s1 |
| InChIKey | QZOWMPKGUNTIGK-ZAFKLKSISA-N |
| XLogP | 3.55 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|