C24H40N3O8P — CID 144729029
(Z)-3-[formyl-[3-methoxy-4-[(1-oxopropan-2-ylamino)-phenoxyphosphoryl]oxybutyl]amino]-N,2-dimethylprop-2-enamide;2-methoxypropane (PubChem CID 144729029) has the molecular formula C24H40N3O8P and a molecular weight of 529.57 g/mol. Its IUPAC name is (Z)-3-[formyl-[3-methoxy-4-[(1-oxopropan-2-ylamino)-phenoxyphosphoryl]oxybutyl]amino]-N,2-dimethylprop-2-enamide;2-methoxypropane.
| Compound Name | (Z)-3-[formyl-[3-methoxy-4-[(1-oxopropan-2-ylamino)-phenoxyphosphoryl]oxybutyl]amino]-N,2-dimethylprop-2-enamide;2-methoxypropane |
|---|---|
| PubChem CID | 144729029 |
| Molecular Formula | C24H40N3O8P |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (Z)-3-[formyl-[3-methoxy-4-[(1-oxopropan-2-ylamino)-phenoxyphosphoryl]oxybutyl]amino]-N,2-dimethylprop-2-enamide;2-methoxypropane |
| SMILES | CNC(=O)/C(C)=C\N(C=O)CCC(COP(=O)(NC(C)C=O)Oc1ccccc1)OC.COC(C)C |
| InChI | InChI=1S/C20H30N3O7P.C4H10O/c1-16(20(26)21-3)12-23(15-25)11-10-19(28-4)14-29-31(27,22-17(2)13-24)30-18-8-6-5-7-9-18;1-4(2)5-3/h5-9,12-13,15,17,19H,10-11,14H2,1-4H3,(H,21,26)(H,22,27);4H,1-3H3/b16-12-; |
| InChIKey | KJORUFGXXRIVCJ-PXJKFVASSA-N |
| XLogP | 2.92 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|