About (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron
(2R)-N-diphenoxyphosphorylpropan-2-amine;hydron (PubChem CID 139084842) has the molecular formula C15H18NO3P
and a molecular weight of 291.29 g/mol. Its IUPAC name is (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron.
Molecular Properties
| Compound Name | (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron |
| PubChem CID | 139084842 |
| Molecular Formula | C15H18NO3P |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron |
| SMILES | [CH2-][C@H](C)NP(=O)(Oc1ccccc1)Oc1ccccc1.[H+] |
| InChI | InChI=1S/C15H17NO3P/c1-13(2)16-20(17,18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-13H,1H2,2H3,(H,16,17)/q-1/p+1/t13-/m1/s1 |
| InChIKey | SZTOULZPBAAGMV-CYBMUJFWSA-O |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron?
The IUPAC name of (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron (CID 139084842) is (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron.
What is the SMILES notation for (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron?
The canonical SMILES for (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron is [CH2-][C@H](C)NP(=O)(Oc1ccccc1)Oc1ccccc1.[H+].
What is the InChIKey of (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron?
The InChIKey is SZTOULZPBAAGMV-CYBMUJFWSA-O. The full InChI is InChI=1S/C15H17NO3P/c1-13(2)16-20(17,18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15/h3-13H,1H2,2H3,(H,16,17)/q-1/p+1/t13-/m1/s1.
What are the key properties of (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron?
(2R)-N-diphenoxyphosphorylpropan-2-amine;hydron has a molecular weight of 291.29 g/mol, XLogP of 4.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-diphenoxyphosphorylpropan-2-amine;hydron is sourced from PubChem (CID 139084842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).