C21H30N3O7PS — CID 139380343
propan-2-yl 2-[[[4-(2,4-dioxopyrimidin-1-yl)-2-methylsulfanylbutoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 139380343) has the molecular formula C21H30N3O7PS and a molecular weight of 499.53 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-(2,4-dioxopyrimidin-1-yl)-2-methylsulfanylbutoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-(2,4-dioxopyrimidin-1-yl)-2-methylsulfanylbutoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139380343 |
| Molecular Formula | C21H30N3O7PS |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | propan-2-yl 2-[[[4-(2,4-dioxopyrimidin-1-yl)-2-methylsulfanylbutoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CSC(CCn1ccc(=O)[nH]c1=O)COP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C21H30N3O7PS/c1-15(2)30-20(26)16(3)23-32(28,31-17-8-6-5-7-9-17)29-14-18(33-4)10-12-24-13-11-19(25)22-21(24)27/h5-9,11,13,15-16,18H,10,12,14H2,1-4H3,(H,23,28)(H,22,25,27) |
| InChIKey | KFSQNFRLRQLCCR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|