C22H32N3O9PS — CID 167036374
propan-2-yl 2-[[[(3S)-3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 167036374) has the molecular formula C22H32N3O9PS and a molecular weight of 545.55 g/mol. Its IUPAC name is propan-2-yl 2-[[[(3S)-3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(3S)-3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 167036374 |
| Molecular Formula | C22H32N3O9PS |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | propan-2-yl 2-[[[(3S)-3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(COP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1)[C@H](O)C(C)(O)n1ccc(=O)[nH]c1=S |
| InChI | InChI=1S/C22H32N3O9PS/c1-14(2)33-20(28)15(3)24-35(30,34-16-9-7-6-8-10-16)32-13-17(31-5)19(27)22(4,29)25-12-11-18(26)23-21(25)36/h6-12,14-15,17,19,27,29H,13H2,1-5H3,(H,24,30)(H,23,26,36)/t15?,17?,19-,22?,35?/m0/s1 |
| InChIKey | HZOYDRUXFKLBFR-AJNPKQFWSA-N |
| XLogP | 2.08 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|