C22H30ClFN3O9P — CID 144828719
propan-2-yl 2-[[[(2S,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 144828719) has the molecular formula C22H30ClFN3O9P and a molecular weight of 565.92 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144828719 |
| Molecular Formula | C22H30ClFN3O9P |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | propan-2-yl 2-[[[(2S,3R,4R)-4-chloro-4-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3-hydroxy-2-methoxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CO[C@](F)(COP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1)[C@@H](O)[C@@](C)(Cl)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30ClFN3O9P/c1-14(2)35-18(29)15(3)26-37(32,36-16-9-7-6-8-10-16)34-13-22(24,33-5)19(30)21(4,23)27-12-11-17(28)25-20(27)31/h6-12,14-15,19,30H,13H2,1-5H3,(H,26,32)(H,25,28,31)/t15?,19-,21-,22+,37?/m0/s1 |
| InChIKey | YBJSHLZCIOJJJJ-SHJWJYCTSA-N |
| XLogP | 2.25 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|