C13H22N3O9PS — CID 167036384
2-[[[3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl]amino]propanoic acid (PubChem CID 167036384) has the molecular formula C13H22N3O9PS and a molecular weight of 427.37 g/mol. Its IUPAC name is 2-[[[3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 167036384 |
| Molecular Formula | C13H22N3O9PS |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-[[[3,4-dihydroxy-2-methoxy-4-(4-oxo-2-sulfanylidenepyrimidin-1-yl)pentoxy]-hydroxyphosphoryl]amino]propanoic acid |
| SMILES | COC(COP(=O)(O)NC(C)C(=O)O)C(O)C(C)(O)n1ccc(=O)[nH]c1=S |
| InChI | InChI=1S/C13H22N3O9PS/c1-7(11(19)20)15-26(22,23)25-6-8(24-3)10(18)13(2,21)16-5-4-9(17)14-12(16)27/h4-5,7-8,10,18,21H,6H2,1-3H3,(H,19,20)(H,14,17,27)(H2,15,22,23) |
| InChIKey | WYSGUKUUGBKVMF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|