C10H16N2O6 — CID 70640618
1-[(2S,3R,4R)-2,3,5-trihydroxy-4-methoxypentan-2-yl]pyrimidine-2,4-dione (PubChem CID 70640618) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-[(2S,3R,4R)-2,3,5-trihydroxy-4-methoxypentan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4R)-2,3,5-trihydroxy-4-methoxypentan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70640618 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[(2S,3R,4R)-2,3,5-trihydroxy-4-methoxypentan-2-yl]pyrimidine-2,4-dione |
| SMILES | CO[C@H](CO)[C@@H](O)[C@](C)(O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N2O6/c1-10(17,8(15)6(5-13)18-2)12-4-3-7(14)11-9(12)16/h3-4,6,8,13,15,17H,5H2,1-2H3,(H,11,14,16)/t6-,8-,10+/m1/s1 |
| InChIKey | FUQMOVGDVVHWOB-YNEQXMIYSA-N |
| XLogP | -2.43 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |