C6H8N2O4 — CID 131057862
1-(2,2-dihydroxyethyl)pyrimidine-2,4-dione (PubChem CID 131057862) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,2-dihydroxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 131057862 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-(2,2-dihydroxyethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CC(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O4/c9-4-1-2-8(3-5(10)11)6(12)7-4/h1-2,5,10-11H,3H2,(H,7,9,12) |
| InChIKey | OKNYYYAWWSXADD-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|