C14H13N3O5 — CID 162789611
2-benzamido-3-(2,4-dioxopyrimidin-1-yl)propanoic acid (PubChem CID 162789611) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-benzamido-3-(2,4-dioxopyrimidin-1-yl)propanoic acid.
| Compound Name | 2-benzamido-3-(2,4-dioxopyrimidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 162789611 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-benzamido-3-(2,4-dioxopyrimidin-1-yl)propanoic acid |
| SMILES | O=C(NC(Cn1ccc(=O)[nH]c1=O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O5/c18-11-6-7-17(14(22)16-11)8-10(13(20)21)15-12(19)9-4-2-1-3-5-9/h1-7,10H,8H2,(H,15,19)(H,20,21)(H,16,18,22) |
| InChIKey | JPXKKBFQAFUYBH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |