C8H11N3O4 — CID 53462120
2-amino-4-(2,4-dioxopyrimidin-1-yl)butanoic acid (PubChem CID 53462120) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-amino-4-(2,4-dioxopyrimidin-1-yl)butanoic acid.
| Compound Name | 2-amino-4-(2,4-dioxopyrimidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 53462120 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-amino-4-(2,4-dioxopyrimidin-1-yl)butanoic acid |
| SMILES | NC(CCn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C8H11N3O4/c9-5(7(13)14)1-3-11-4-2-6(12)10-8(11)15/h2,4-5H,1,3,9H2,(H,13,14)(H,10,12,15) |
| InChIKey | JRUDOTYRCSMXFT-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |