C12H18N2O6 — CID 172580838
[4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 2-methoxyacetate (PubChem CID 172580838) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 2-methoxyacetate.
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 172580838 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(CCn1ccc(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C12H18N2O6/c1-18-8-11(16)20-7-9(19-2)3-5-14-6-4-10(15)13-12(14)17/h4,6,9H,3,5,7-8H2,1-2H3,(H,13,15,17) |
| InChIKey | AAKYSHOHVFTINJ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |