About [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate
[2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate (PubChem CID 153342480) has the molecular formula C12H19N3O5
and a molecular weight of 285.30 g/mol. Its IUPAC name is [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate.
Molecular Properties
| Compound Name | [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate |
| PubChem CID | 153342480 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate |
| SMILES | COC(CCn1cc(C)c(=O)[nH]c1=O)COC(=O)CN |
| InChI | InChI=1S/C12H19N3O5/c1-8-6-15(12(18)14-11(8)17)4-3-9(19-2)7-20-10(16)5-13/h6,9H,3-5,7,13H2,1-2H3,(H,14,17,18) |
| InChIKey | OJEZGFXGGYYTQH-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate?
The IUPAC name of [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate (CID 153342480) is [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate.
What is the SMILES notation for [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate?
The canonical SMILES for [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate is COC(CCn1cc(C)c(=O)[nH]c1=O)COC(=O)CN.
What is the InChIKey of [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate?
The InChIKey is OJEZGFXGGYYTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O5/c1-8-6-15(12(18)14-11(8)17)4-3-9(19-2)7-20-10(16)5-13/h6,9H,3-5,7,13H2,1-2H3,(H,14,17,18).
What are the key properties of [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate?
[2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate has a molecular weight of 285.30 g/mol, XLogP of -1.25, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-4-(5-methyl-2,4-dioxopyrimidin-1-yl)butyl] 2-aminoacetate is sourced from PubChem (CID 153342480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).