About [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate
[4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate (PubChem CID 172580602) has the molecular formula C18H28N2O6
and a molecular weight of 368.43 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate |
| PubChem CID | 172580602 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate |
| SMILES | COC(CCn1ccc(=O)[nH]c1=O)COC(=O)C1(OC(C)C)CCCC1 |
| InChI | InChI=1S/C18H28N2O6/c1-13(2)26-18(8-4-5-9-18)16(22)25-12-14(24-3)6-10-20-11-7-15(21)19-17(20)23/h7,11,13-14H,4-6,8-10,12H2,1-3H3,(H,19,21,23) |
| InChIKey | HNXRFUPRNUDUSC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate?
The IUPAC name of [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate (CID 172580602) is [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate.
What is the SMILES notation for [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate?
The canonical SMILES for [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate is COC(CCn1ccc(=O)[nH]c1=O)COC(=O)C1(OC(C)C)CCCC1.
What is the InChIKey of [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate?
The InChIKey is HNXRFUPRNUDUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O6/c1-13(2)26-18(8-4-5-9-18)16(22)25-12-14(24-3)6-10-20-11-7-15(21)19-17(20)23/h7,11,13-14H,4-6,8-10,12H2,1-3H3,(H,19,21,23).
What are the key properties of [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate?
[4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 1.22, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] 1-propan-2-yloxycyclopentane-1-carboxylate is sourced from PubChem (CID 172580602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).