C16H24N2O5 — CID 172580558
[4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] cyclohexanecarboxylate (PubChem CID 172580558) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] cyclohexanecarboxylate.
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 172580558 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxybutyl] cyclohexanecarboxylate |
| SMILES | COC(CCn1ccc(=O)[nH]c1=O)COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H24N2O5/c1-22-13(7-9-18-10-8-14(19)17-16(18)21)11-23-15(20)12-5-3-2-4-6-12/h8,10,12-13H,2-7,9,11H2,1H3,(H,17,19,21) |
| InChIKey | AVSLFKWQTNMMSO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |