C15H22N2O5S — CID 178006585
[4-(2,4-dioxopyrimidin-1-yl)-2-methoxypentyl] thiolane-2-carboxylate (PubChem CID 178006585) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is [4-(2,4-dioxopyrimidin-1-yl)-2-methoxypentyl] thiolane-2-carboxylate.
| Compound Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxypentyl] thiolane-2-carboxylate |
|---|---|
| PubChem CID | 178006585 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [4-(2,4-dioxopyrimidin-1-yl)-2-methoxypentyl] thiolane-2-carboxylate |
| SMILES | COC(COC(=O)C1CCCS1)CC(C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H22N2O5S/c1-10(17-6-5-13(18)16-15(17)20)8-11(21-2)9-22-14(19)12-4-3-7-23-12/h5-6,10-12H,3-4,7-9H2,1-2H3,(H,16,18,20) |
| InChIKey | RICSOTVNMVAHJG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |