C8H12N2O3 — CID 123506257
1-(1-hydroxy-2-methylpropyl)pyrimidine-2,4-dione (PubChem CID 123506257) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropyl)pyrimidine-2,4-dione.
| Compound Name | 1-(1-hydroxy-2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123506257 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropyl)pyrimidine-2,4-dione |
| SMILES | CC(C)C(O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C8H12N2O3/c1-5(2)7(12)10-4-3-6(11)9-8(10)13/h3-5,7,12H,1-2H3,(H,9,11,13) |
| InChIKey | AFCPGGQWKRHXCK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |