C11H15N3O5 — CID 143809467
1-[(1R)-1-[(2R,3S)-2-amino-1,3-dihydroxypent-4-yn-2-yl]oxyethyl]pyrimidine-2,4-dione (PubChem CID 143809467) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-[(1R)-1-[(2R,3S)-2-amino-1,3-dihydroxypent-4-yn-2-yl]oxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-1-[(2R,3S)-2-amino-1,3-dihydroxypent-4-yn-2-yl]oxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143809467 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[(1R)-1-[(2R,3S)-2-amino-1,3-dihydroxypent-4-yn-2-yl]oxyethyl]pyrimidine-2,4-dione |
| SMILES | C#C[C@H](O)[C@@](N)(CO)O[C@H](C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O5/c1-3-8(16)11(12,6-15)19-7(2)14-5-4-9(17)13-10(14)18/h1,4-5,7-8,15-16H,6,12H2,2H3,(H,13,17,18)/t7-,8+,11-/m1/s1 |
| InChIKey | LAGVHLGDNCOVKC-VHSKPIJISA-N |
| XLogP | -2.29 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|