C11H14N2O7 — CID 130311727
(2S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxoethoxy]-2-(hydroxymethyl)-3-methoxypropanal (PubChem CID 130311727) has the molecular formula C11H14N2O7 and a molecular weight of 286.24 g/mol. Its IUPAC name is (2S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxoethoxy]-2-(hydroxymethyl)-3-methoxypropanal.
| Compound Name | (2S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxoethoxy]-2-(hydroxymethyl)-3-methoxypropanal |
|---|---|
| PubChem CID | 130311727 |
| Molecular Formula | C11H14N2O7 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (2S)-2-[(1R)-1-(2,4-dioxopyrimidin-1-yl)-2-oxoethoxy]-2-(hydroxymethyl)-3-methoxypropanal |
| SMILES | COC[C@](C=O)(CO)O[C@H](C=O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N2O7/c1-19-7-11(5-15,6-16)20-9(4-14)13-3-2-8(17)12-10(13)18/h2-5,9,16H,6-7H2,1H3,(H,12,17,18)/t9-,11+/m1/s1 |
| InChIKey | PWEOCIOAZCMVFQ-KOLCDFICSA-N |
| XLogP | -2.17 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|