C9H14N2O2 — CID 91224356
1-pentan-3-ylpyrimidine-2,4-dione (PubChem CID 91224356) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-pentan-3-ylpyrimidine-2,4-dione.
| Compound Name | 1-pentan-3-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91224356 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-pentan-3-ylpyrimidine-2,4-dione |
| SMILES | CCC(CC)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N2O2/c1-3-7(4-2)11-6-5-8(12)10-9(11)13/h5-7H,3-4H2,1-2H3,(H,10,12,13) |
| InChIKey | MJCMIADMVUZWAR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |