C14H26N2O3S — CID 156889949
ethane;1-[1-(6-sulfanylhexan-3-yloxy)ethyl]pyrimidine-2,4-dione (PubChem CID 156889949) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is ethane;1-[1-(6-sulfanylhexan-3-yloxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | ethane;1-[1-(6-sulfanylhexan-3-yloxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156889949 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethane;1-[1-(6-sulfanylhexan-3-yloxy)ethyl]pyrimidine-2,4-dione |
| SMILES | CC.CCC(CCCS)OC(C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H20N2O3S.C2H6/c1-3-10(5-4-8-18)17-9(2)14-7-6-11(15)13-12(14)16;1-2/h6-7,9-10,18H,3-5,8H2,1-2H3,(H,13,15,16);1-2H3 |
| InChIKey | DDZPIZDKOLCHOP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|