C11H14N2O4 — CID 144582240
1-[1-(1-hydroxypent-4-yn-2-yloxy)ethyl]pyrimidine-2,4-dione (PubChem CID 144582240) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-[1-(1-hydroxypent-4-yn-2-yloxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[1-(1-hydroxypent-4-yn-2-yloxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144582240 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-[1-(1-hydroxypent-4-yn-2-yloxy)ethyl]pyrimidine-2,4-dione |
| SMILES | C#CCC(CO)OC(C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N2O4/c1-3-4-9(7-14)17-8(2)13-6-5-10(15)12-11(13)16/h1,5-6,8-9,14H,4,7H2,2H3,(H,12,15,16) |
| InChIKey | YLQDCNXGRFLRFH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|