C10H14FN2O6P — CID 134595189
1-[(1R)-1-[(2R,3R)-4-fluoro-3-hydroxy-1-phosphorosooxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione (PubChem CID 134595189) has the molecular formula C10H14FN2O6P and a molecular weight of 308.20 g/mol. Its IUPAC name is 1-[(1R)-1-[(2R,3R)-4-fluoro-3-hydroxy-1-phosphorosooxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-1-[(2R,3R)-4-fluoro-3-hydroxy-1-phosphorosooxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134595189 |
| Molecular Formula | C10H14FN2O6P |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[(1R)-1-[(2R,3R)-4-fluoro-3-hydroxy-1-phosphorosooxybutan-2-yl]oxyethyl]pyrimidine-2,4-dione |
| SMILES | C[C@@H](O[C@H](COP=O)[C@@H](O)CF)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14FN2O6P/c1-6(13-3-2-9(15)12-10(13)16)19-8(5-18-20-17)7(14)4-11/h2-3,6-8,14H,4-5H2,1H3,(H,12,15,16)/t6-,7+,8-/m1/s1 |
| InChIKey | SBHPJBOEQNKZAV-GJMOJQLCSA-N |
| XLogP | -0.01 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|