C9H11Br2N2O6P — CID 126647682
1-[(1R)-2-bromo-1-[(1S,2R)-1-bromo-1-hydroxy-3-phosphorosooxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione (PubChem CID 126647682) has the molecular formula C9H11Br2N2O6P and a molecular weight of 433.98 g/mol. Its IUPAC name is 1-[(1R)-2-bromo-1-[(1S,2R)-1-bromo-1-hydroxy-3-phosphorosooxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-2-bromo-1-[(1S,2R)-1-bromo-1-hydroxy-3-phosphorosooxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126647682 |
| Molecular Formula | C9H11Br2N2O6P |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 431.87 |
| IUPAC Name | 1-[(1R)-2-bromo-1-[(1S,2R)-1-bromo-1-hydroxy-3-phosphorosooxypropan-2-yl]oxyethyl]pyrimidine-2,4-dione |
| SMILES | O=POC[C@@H](O[C@H](CBr)n1ccc(=O)[nH]c1=O)[C@@H](O)Br |
| InChI | InChI=1S/C9H11Br2N2O6P/c10-3-7(13-2-1-6(14)12-9(13)16)19-5(8(11)15)4-18-20-17/h1-2,5,7-8,15H,3-4H2,(H,12,14,16)/t5-,7-,8-/m1/s1 |
| InChIKey | XZRUCUDULOLBBE-LPBLVHEISA-N |
| XLogP | 0.75 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|