C9H14N2O5 — CID 167508864
1-[1-(2-hydroxyethoxy)-2-methoxyethyl]pyrimidine-2,4-dione (PubChem CID 167508864) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethoxy)-2-methoxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[1-(2-hydroxyethoxy)-2-methoxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167508864 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-[1-(2-hydroxyethoxy)-2-methoxyethyl]pyrimidine-2,4-dione |
| SMILES | COCC(OCCO)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14N2O5/c1-15-6-8(16-5-4-12)11-3-2-7(13)10-9(11)14/h2-3,8,12H,4-6H2,1H3,(H,10,13,14) |
| InChIKey | FKPQQHLZEAVHDA-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |