C14H23N2O9P — CID 163767382
1-[(1R)-1-[(E,2R)-4-dimethoxyphosphoryl-1-(2-hydroxyethoxy)but-3-en-2-yl]oxy-2-hydroxyethyl]pyrimidine-2,4-dione (PubChem CID 163767382) has the molecular formula C14H23N2O9P and a molecular weight of 394.32 g/mol. Its IUPAC name is 1-[(1R)-1-[(E,2R)-4-dimethoxyphosphoryl-1-(2-hydroxyethoxy)but-3-en-2-yl]oxy-2-hydroxyethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-1-[(E,2R)-4-dimethoxyphosphoryl-1-(2-hydroxyethoxy)but-3-en-2-yl]oxy-2-hydroxyethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163767382 |
| Molecular Formula | C14H23N2O9P |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[(1R)-1-[(E,2R)-4-dimethoxyphosphoryl-1-(2-hydroxyethoxy)but-3-en-2-yl]oxy-2-hydroxyethyl]pyrimidine-2,4-dione |
| SMILES | COP(=O)(/C=C/[C@H](COCCO)O[C@H](CO)n1ccc(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C14H23N2O9P/c1-22-26(21,23-2)8-4-11(10-24-7-6-17)25-13(9-18)16-5-3-12(19)15-14(16)20/h3-5,8,11,13,17-18H,6-7,9-10H2,1-2H3,(H,15,19,20)/b8-4+/t11-,13-/m1/s1 |
| InChIKey | MDNBDUQLBQIWPU-GRPWJJFYSA-N |
| XLogP | -0.58 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|