C9H15N2O7P — CID 11254871
[3-(2,4-dioxopyrimidin-1-yl)-4-hydroxybutoxy]methylphosphonic acid (PubChem CID 11254871) has the molecular formula C9H15N2O7P and a molecular weight of 294.20 g/mol. Its IUPAC name is [3-(2,4-dioxopyrimidin-1-yl)-4-hydroxybutoxy]methylphosphonic acid.
| Compound Name | [3-(2,4-dioxopyrimidin-1-yl)-4-hydroxybutoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 11254871 |
| Molecular Formula | C9H15N2O7P |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [3-(2,4-dioxopyrimidin-1-yl)-4-hydroxybutoxy]methylphosphonic acid |
| SMILES | O=c1ccn(C(CO)CCOCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H15N2O7P/c12-5-7(2-4-18-6-19(15,16)17)11-3-1-8(13)10-9(11)14/h1,3,7,12H,2,4-6H2,(H,10,13,14)(H2,15,16,17) |
| InChIKey | AQFPYAQSEDMQGL-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|